C20H19FN2O7S — CID 11374344
3-[(2R,3R,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-6-fluoro-1,3-benzoxazole-2-thione (PubChem CID 11374344) has the molecular formula C20H19FN2O7S and a molecular weight of 450.44 g/mol. Its IUPAC name is 3-[(2R,3R,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-6-fluoro-1,3-benzoxazole-2-thione.
| Compound Name | 3-[(2R,3R,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-6-fluoro-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 11374344 |
| Molecular Formula | C20H19FN2O7S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 3-[(2R,3R,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-6-fluoro-1,3-benzoxazole-2-thione |
| SMILES | COC(OC)[C@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H](n2c(=S)oc3cc(F)ccc32)[C@H]1O |
| InChI | InChI=1S/C20H19FN2O7S/c1-20(18(27-2)28-3)17(24)16(12-9-11(23(25)26)5-7-14(12)30-20)22-13-6-4-10(21)8-15(13)29-19(22)31/h4-9,16-18,24H,1-3H3/t16-,17-,20-/m1/s1 |
| InChIKey | FVMAVNFCBAIALN-MBOZVWFJSA-N |
| XLogP | 3.73 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|