C24H28N2O9 — CID 68566872
[(2S)-1-[(2S,3S,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-3,4-dihydro-2H-quinolin-2-yl] methyl carbonate (PubChem CID 68566872) has the molecular formula C24H28N2O9 and a molecular weight of 488.49 g/mol. Its IUPAC name is [(2S)-1-[(2S,3S,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-3,4-dihydro-2H-quinolin-2-yl] methyl carbonate.
| Compound Name | [(2S)-1-[(2S,3S,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-3,4-dihydro-2H-quinolin-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 68566872 |
| Molecular Formula | C24H28N2O9 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [(2S)-1-[(2S,3S,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-3,4-dihydro-2H-quinolin-2-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1CCc2ccccc2N1[C@@H]1c2cc([N+](=O)[O-])ccc2O[C@](C)(C(OC)OC)[C@H]1O |
| InChI | InChI=1S/C24H28N2O9/c1-24(22(31-2)32-3)21(27)20(16-13-15(26(29)30)10-11-18(16)35-24)25-17-8-6-5-7-14(17)9-12-19(25)34-23(28)33-4/h5-8,10-11,13,19-22,27H,9,12H2,1-4H3/t19-,20+,21-,24-/m0/s1 |
| InChIKey | BGYNSULHQIREHI-XARGGIHNSA-N |
| XLogP | 3.33 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|