C13H15NO6 — CID 142629975
2,2-bis(methoxymethyl)-6-nitrochromen-3-ol (PubChem CID 142629975) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 2,2-bis(methoxymethyl)-6-nitrochromen-3-ol.
| Compound Name | 2,2-bis(methoxymethyl)-6-nitrochromen-3-ol |
|---|---|
| PubChem CID | 142629975 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2,2-bis(methoxymethyl)-6-nitrochromen-3-ol |
| SMILES | COCC1(COC)Oc2ccc([N+](=O)[O-])cc2C=C1O |
| InChI | InChI=1S/C13H15NO6/c1-18-7-13(8-19-2)12(15)6-9-5-10(14(16)17)3-4-11(9)20-13/h3-6,15H,7-8H2,1-2H3 |
| InChIKey | DGHVROJJTOPEKE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|