C15H18N2O3 — CID 2865135
N-ethyl-7-nitro-1,2,3,4-tetrahydroxanthen-4a-amine (PubChem CID 2865135) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-ethyl-7-nitro-1,2,3,4-tetrahydroxanthen-4a-amine.
| Compound Name | N-ethyl-7-nitro-1,2,3,4-tetrahydroxanthen-4a-amine |
|---|---|
| PubChem CID | 2865135 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-ethyl-7-nitro-1,2,3,4-tetrahydroxanthen-4a-amine |
| SMILES | CCNC12CCCCC1=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C15H18N2O3/c1-2-16-15-8-4-3-5-12(15)9-11-10-13(17(18)19)6-7-14(11)20-15/h6-7,9-10,16H,2-5,8H2,1H3 |
| InChIKey | NWXQSSSCNIURAB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|