C17H20N2O4 — CID 698863
4-[(4aR)-7-nitro-1,2,3,4-tetrahydroxanthen-4a-yl]morpholine (PubChem CID 698863) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-[(4aR)-7-nitro-1,2,3,4-tetrahydroxanthen-4a-yl]morpholine.
| Compound Name | 4-[(4aR)-7-nitro-1,2,3,4-tetrahydroxanthen-4a-yl]morpholine |
|---|---|
| PubChem CID | 698863 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-[(4aR)-7-nitro-1,2,3,4-tetrahydroxanthen-4a-yl]morpholine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C=C1CCCC[C@@]1(N1CCOCC1)O2 |
| InChI | InChI=1S/C17H20N2O4/c20-19(21)15-4-5-16-13(12-15)11-14-3-1-2-6-17(14,23-16)18-7-9-22-10-8-18/h4-5,11-12H,1-3,6-10H2/t17-/m1/s1 |
| InChIKey | FHAYFSMLDULMNT-QGZVFWFLSA-N |
| XLogP | 2.97 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|