C19H18ClN3O3 — CID 23731889
7-chloro-5-nitro-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydroxanthen-4a-amine (PubChem CID 23731889) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is 7-chloro-5-nitro-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydroxanthen-4a-amine.
| Compound Name | 7-chloro-5-nitro-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydroxanthen-4a-amine |
|---|---|
| PubChem CID | 23731889 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 7-chloro-5-nitro-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydroxanthen-4a-amine |
| SMILES | O=[N+]([O-])c1cc(Cl)cc2c1OC1(NCc3cccnc3)CCCCC1=C2 |
| InChI | InChI=1S/C19H18ClN3O3/c20-16-9-14-8-15-5-1-2-6-19(15,22-12-13-4-3-7-21-11-13)26-18(14)17(10-16)23(24)25/h3-4,7-11,22H,1-2,5-6,12H2 |
| InChIKey | IVJSMIPYIKVDPG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|