C13H20Cl2N2O2 — CID 53422261
1-(pyridin-3-ylmethylamino)cyclohexane-1-carboxylic acid;dihydrochloride (PubChem CID 53422261) has the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 1-(pyridin-3-ylmethylamino)cyclohexane-1-carboxylic acid;dihydrochloride.
| Compound Name | 1-(pyridin-3-ylmethylamino)cyclohexane-1-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 53422261 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-(pyridin-3-ylmethylamino)cyclohexane-1-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)C1(NCc2cccnc2)CCCCC1 |
| InChI | InChI=1S/C13H18N2O2.2ClH/c16-12(17)13(6-2-1-3-7-13)15-10-11-5-4-8-14-9-11;;/h4-5,8-9,15H,1-3,6-7,10H2,(H,16,17);2*1H |
| InChIKey | UOIPWCQPOATNSA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |