C12H15N3O4 — CID 64890825
3-(pyridin-3-ylmethylcarbamoylamino)oxolane-3-carboxylic acid (PubChem CID 64890825) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-(pyridin-3-ylmethylcarbamoylamino)oxolane-3-carboxylic acid.
| Compound Name | 3-(pyridin-3-ylmethylcarbamoylamino)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 64890825 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-(pyridin-3-ylmethylcarbamoylamino)oxolane-3-carboxylic acid |
| SMILES | O=C(NCc1cccnc1)NC1(C(=O)O)CCOC1 |
| InChI | InChI=1S/C12H15N3O4/c16-10(17)12(3-5-19-8-12)15-11(18)14-7-9-2-1-4-13-6-9/h1-2,4,6H,3,5,7-8H2,(H,16,17)(H2,14,15,18) |
| InChIKey | JHSFCVWIMLBPAY-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |