C14H18N2O5 — CID 106528154
4-[(4-hydroxyphenyl)methylcarbamoylamino]oxane-4-carboxylic acid (PubChem CID 106528154) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-[(4-hydroxyphenyl)methylcarbamoylamino]oxane-4-carboxylic acid.
| Compound Name | 4-[(4-hydroxyphenyl)methylcarbamoylamino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 106528154 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-[(4-hydroxyphenyl)methylcarbamoylamino]oxane-4-carboxylic acid |
| SMILES | O=C(NCc1ccc(O)cc1)NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C14H18N2O5/c17-11-3-1-10(2-4-11)9-15-13(20)16-14(12(18)19)5-7-21-8-6-14/h1-4,17H,5-9H2,(H,18,19)(H2,15,16,20) |
| InChIKey | FDYNCVANCGZLOD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |