C13H16FNO2 — CID 114990344
1-[(4-fluorophenyl)methylamino]cyclopentane-1-carboxylic acid (PubChem CID 114990344) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methylamino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(4-fluorophenyl)methylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114990344 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-[(4-fluorophenyl)methylamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(NCc2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C13H16FNO2/c14-11-5-3-10(4-6-11)9-15-13(12(16)17)7-1-2-8-13/h3-6,15H,1-2,7-9H2,(H,16,17) |
| InChIKey | YSEXCUAWMKRGQI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |