C19H19Cl2N3O2 — CID 119108315
3-[(6,8-dichloro-2H-chromen-3-yl)methylamino]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 119108315) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 3-[(6,8-dichloro-2H-chromen-3-yl)methylamino]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[(6,8-dichloro-2H-chromen-3-yl)methylamino]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119108315 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 3-[(6,8-dichloro-2H-chromen-3-yl)methylamino]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | O=C(CCNCC1=Cc2cc(Cl)cc(Cl)c2OC1)NCc1cccnc1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c20-16-7-15-6-14(12-26-19(15)17(21)8-16)10-23-5-3-18(25)24-11-13-2-1-4-22-9-13/h1-2,4,6-9,23H,3,5,10-12H2,(H,24,25) |
| InChIKey | OLIMHSRWFLYVSH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|