C17H18ClF2N3O2 — CID 119127097
3-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 119127097) has the molecular formula C17H18ClF2N3O2 and a molecular weight of 369.80 g/mol. Its IUPAC name is 3-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119127097 |
| Molecular Formula | C17H18ClF2N3O2 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 3-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | O=C(CCNCc1ccc(OC(F)F)c(Cl)c1)NCc1cccnc1 |
| InChI | InChI=1S/C17H18ClF2N3O2/c18-14-8-12(3-4-15(14)25-17(19)20)9-22-7-5-16(24)23-11-13-2-1-6-21-10-13/h1-4,6,8,10,17,22H,5,7,9,11H2,(H,23,24) |
| InChIKey | QHVREYLGTOZKMF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|