C15H14ClF2N3O2 — CID 71868680
1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 71868680) has the molecular formula C15H14ClF2N3O2 and a molecular weight of 341.75 g/mol. Its IUPAC name is 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 71868680 |
| Molecular Formula | C15H14ClF2N3O2 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C15H14ClF2N3O2/c16-12-3-4-13(23-14(17)18)11(6-12)9-21-15(22)20-8-10-2-1-5-19-7-10/h1-7,14H,8-9H2,(H2,20,21,22) |
| InChIKey | RSTHBHRXZKDWAG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |