C20H20N4O3S — CID 119114272
3-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methylamino]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 119114272) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methylamino]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methylamino]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119114272 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methylamino]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | O=C(CCNCc1csc(-c2ccc3c(c2)OCO3)n1)NCc1cccnc1 |
| InChI | InChI=1S/C20H20N4O3S/c25-19(23-10-14-2-1-6-21-9-14)5-7-22-11-16-12-28-20(24-16)15-3-4-17-18(8-15)27-13-26-17/h1-4,6,8-9,12,22H,5,7,10-11,13H2,(H,23,25) |
| InChIKey | JPPZYKIFEWSQAK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|