C8H3F4NO4 — CID 13255697
2,2,3,3-tetrafluoro-6-nitro-1,4-benzodioxine (PubChem CID 13255697) has the molecular formula C8H3F4NO4 and a molecular weight of 253.11 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-6-nitro-1,4-benzodioxine.
| Compound Name | 2,2,3,3-tetrafluoro-6-nitro-1,4-benzodioxine |
|---|---|
| PubChem CID | 13255697 |
| Molecular Formula | C8H3F4NO4 |
| Molecular Weight | 253.11 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 2,2,3,3-tetrafluoro-6-nitro-1,4-benzodioxine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C8H3F4NO4/c9-7(10)8(11,12)17-6-3-4(13(14)15)1-2-5(6)16-7/h1-3H |
| InChIKey | HFHAJBUXJRZUAZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.11 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|