C8H4F2N2O3 — CID 139905823
2,2-difluoro-7-nitro-1,4-benzoxazine (PubChem CID 139905823) has the molecular formula C8H4F2N2O3 and a molecular weight of 214.13 g/mol. Its IUPAC name is 2,2-difluoro-7-nitro-1,4-benzoxazine.
| Compound Name | 2,2-difluoro-7-nitro-1,4-benzoxazine |
|---|---|
| PubChem CID | 139905823 |
| Molecular Formula | C8H4F2N2O3 |
| Molecular Weight | 214.13 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 2,2-difluoro-7-nitro-1,4-benzoxazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OC(F)(F)C=N2 |
| InChI | InChI=1S/C8H4F2N2O3/c9-8(10)4-11-6-2-1-5(12(13)14)3-7(6)15-8/h1-4H |
| InChIKey | LBUPHIUOAQLFCD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.13 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|