C10H4ClF6NO4 — CID 54521392
2-(1-chloro-2,2,2-trifluoroethyl)-5-nitro-2-(trifluoromethyl)-1,3-benzodioxole (PubChem CID 54521392) has the molecular formula C10H4ClF6NO4 and a molecular weight of 351.59 g/mol. Its IUPAC name is 2-(1-chloro-2,2,2-trifluoroethyl)-5-nitro-2-(trifluoromethyl)-1,3-benzodioxole.
| Compound Name | 2-(1-chloro-2,2,2-trifluoroethyl)-5-nitro-2-(trifluoromethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 54521392 |
| Molecular Formula | C10H4ClF6NO4 |
| Molecular Weight | 351.59 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 2-(1-chloro-2,2,2-trifluoroethyl)-5-nitro-2-(trifluoromethyl)-1,3-benzodioxole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OC(C(Cl)C(F)(F)F)(C(F)(F)F)O2 |
| InChI | InChI=1S/C10H4ClF6NO4/c11-7(9(12,13)14)8(10(15,16)17)21-5-2-1-4(18(19)20)3-6(5)22-8/h1-3,7H |
| InChIKey | YQBVPERHIQTLMT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|