C11H9NO8 — CID 66929592
2-ethoxycarbonyl-5-nitro-1,3-benzodioxole-2-carboxylic acid (PubChem CID 66929592) has the molecular formula C11H9NO8 and a molecular weight of 283.19 g/mol. Its IUPAC name is 2-ethoxycarbonyl-5-nitro-1,3-benzodioxole-2-carboxylic acid.
| Compound Name | 2-ethoxycarbonyl-5-nitro-1,3-benzodioxole-2-carboxylic acid |
|---|---|
| PubChem CID | 66929592 |
| Molecular Formula | C11H9NO8 |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 2-ethoxycarbonyl-5-nitro-1,3-benzodioxole-2-carboxylic acid |
| SMILES | CCOC(=O)C1(C(=O)O)Oc2ccc([N+](=O)[O-])cc2O1 |
| InChI | InChI=1S/C11H9NO8/c1-2-18-10(15)11(9(13)14)19-7-4-3-6(12(16)17)5-8(7)20-11/h3-5H,2H2,1H3,(H,13,14) |
| InChIKey | RETYLLSMHUBNST-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|