About diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate
diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate (PubChem CID 100953904) has the molecular formula C23H17NO9
and a molecular weight of 451.39 g/mol. Its IUPAC name is diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate |
| PubChem CID | 100953904 |
| Molecular Formula | C23H17NO9 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C2=C(Oc3cc([N+](=O)[O-])ccc31)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H17NO9/c1-3-31-21(27)23(22(28)32-4-2)15-10-9-12(24(29)30)11-16(15)33-20-17(23)18(25)13-7-5-6-8-14(13)19(20)26/h5-11H,3-4H2,1-2H3 |
| InChIKey | FBEFNNVBTNMYEY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 139.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate?
The IUPAC name of diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate (CID 100953904) is diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate.
What is the SMILES notation for diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate?
The canonical SMILES for diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate is CCOC(=O)C1(C(=O)OCC)C2=C(Oc3cc([N+](=O)[O-])ccc31)C(=O)c1ccccc1C2=O.
What is the InChIKey of diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate?
The InChIKey is FBEFNNVBTNMYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO9/c1-3-31-21(27)23(22(28)32-4-2)15-10-9-12(24(29)30)11-16(15)33-20-17(23)18(25)13-7-5-6-8-14(13)19(20)26/h5-11H,3-4H2,1-2H3.
What are the key properties of diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate?
diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate has a molecular weight of 451.39 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3-nitro-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate is sourced from PubChem (CID 100953904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).