C16H18N2O7 — CID 44518076
diethyl 1-methyl-6-nitro-2-oxo-3H-quinoline-4,4-dicarboxylate (PubChem CID 44518076) has the molecular formula C16H18N2O7 and a molecular weight of 350.33 g/mol. Its IUPAC name is diethyl 1-methyl-6-nitro-2-oxo-3H-quinoline-4,4-dicarboxylate.
| Compound Name | diethyl 1-methyl-6-nitro-2-oxo-3H-quinoline-4,4-dicarboxylate |
|---|---|
| PubChem CID | 44518076 |
| Molecular Formula | C16H18N2O7 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | diethyl 1-methyl-6-nitro-2-oxo-3H-quinoline-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(=O)N(C)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H18N2O7/c1-4-24-14(20)16(15(21)25-5-2)9-13(19)17(3)12-7-6-10(18(22)23)8-11(12)16/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | YOXLBUCBDYKXRO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|