C21H18F4N2O5 — CID 118526325
ethyl 6-fluoro-4,4-dimethyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-2-oxo-3H-quinoline-7-carboxylate (PubChem CID 118526325) has the molecular formula C21H18F4N2O5 and a molecular weight of 454.38 g/mol. Its IUPAC name is ethyl 6-fluoro-4,4-dimethyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-2-oxo-3H-quinoline-7-carboxylate.
| Compound Name | ethyl 6-fluoro-4,4-dimethyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-2-oxo-3H-quinoline-7-carboxylate |
|---|---|
| PubChem CID | 118526325 |
| Molecular Formula | C21H18F4N2O5 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | ethyl 6-fluoro-4,4-dimethyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-2-oxo-3H-quinoline-7-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cc1F)C(C)(C)CC(=O)N2c1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C21H18F4N2O5/c1-4-32-19(29)12-8-17-13(9-15(12)22)20(2,3)10-18(28)26(17)16-6-5-11(27(30)31)7-14(16)21(23,24)25/h5-9H,4,10H2,1-3H3 |
| InChIKey | BDABUGRSEOLIGU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|