C19H25NO5 — CID 135067401
diethyl 1-butyl-2-oxo-3H-quinoline-4,4-dicarboxylate (PubChem CID 135067401) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is diethyl 1-butyl-2-oxo-3H-quinoline-4,4-dicarboxylate.
| Compound Name | diethyl 1-butyl-2-oxo-3H-quinoline-4,4-dicarboxylate |
|---|---|
| PubChem CID | 135067401 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | diethyl 1-butyl-2-oxo-3H-quinoline-4,4-dicarboxylate |
| SMILES | CCCCN1C(=O)CC(C(=O)OCC)(C(=O)OCC)c2ccccc21 |
| InChI | InChI=1S/C19H25NO5/c1-4-7-12-20-15-11-9-8-10-14(15)19(13-16(20)21,17(22)24-5-2)18(23)25-6-3/h8-11H,4-7,12-13H2,1-3H3 |
| InChIKey | UHRJOTZVENZGQJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|