C24H27NO6 — CID 143313905
ethyl 1-hexyl-3-(6-hydroxy-1,3-benzodioxol-5-yl)-2-oxoindole-3-carboxylate (PubChem CID 143313905) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is ethyl 1-hexyl-3-(6-hydroxy-1,3-benzodioxol-5-yl)-2-oxoindole-3-carboxylate.
| Compound Name | ethyl 1-hexyl-3-(6-hydroxy-1,3-benzodioxol-5-yl)-2-oxoindole-3-carboxylate |
|---|---|
| PubChem CID | 143313905 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | ethyl 1-hexyl-3-(6-hydroxy-1,3-benzodioxol-5-yl)-2-oxoindole-3-carboxylate |
| SMILES | CCCCCCN1C(=O)C(C(=O)OCC)(c2cc3c(cc2O)OCO3)c2ccccc21 |
| InChI | InChI=1S/C24H27NO6/c1-3-5-6-9-12-25-18-11-8-7-10-16(18)24(22(25)27,23(28)29-4-2)17-13-20-21(14-19(17)26)31-15-30-20/h7-8,10-11,13-14,26H,3-6,9,12,15H2,1-2H3 |
| InChIKey | CGPFRSXLGYFOQT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|