C20H21NO4 — CID 54581615
3-(1,3-benzodioxol-5-yl)-3-hydroxy-1-(3-methylbutyl)indol-2-one (PubChem CID 54581615) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-hydroxy-1-(3-methylbutyl)indol-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-hydroxy-1-(3-methylbutyl)indol-2-one |
|---|---|
| PubChem CID | 54581615 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-hydroxy-1-(3-methylbutyl)indol-2-one |
| SMILES | CC(C)CCN1C(=O)C(O)(c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C20H21NO4/c1-13(2)9-10-21-16-6-4-3-5-15(16)20(23,19(21)22)14-7-8-17-18(11-14)25-12-24-17/h3-8,11,13,23H,9-10,12H2,1-2H3 |
| InChIKey | FRUGMWWHKCFJHC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |