C20H19NO4 — CID 12004377
3-(1,3-benzodioxol-5-yl)-1-(2-cyclopropylethyl)-3-hydroxyindol-2-one (PubChem CID 12004377) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-(2-cyclopropylethyl)-3-hydroxyindol-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-(2-cyclopropylethyl)-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 12004377 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-(2-cyclopropylethyl)-3-hydroxyindol-2-one |
| SMILES | O=C1N(CCC2CC2)c2ccccc2C1(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H19NO4/c22-19-20(23,14-7-8-17-18(11-14)25-12-24-17)15-3-1-2-4-16(15)21(19)10-9-13-5-6-13/h1-4,7-8,11,13,23H,5-6,9-10,12H2 |
| InChIKey | QLHOPVVXZWBSDY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |