About methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate
methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate (PubChem CID 12003986) has the molecular formula C23H25NO5
and a molecular weight of 395.46 g/mol. Its IUPAC name is methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate |
| PubChem CID | 12003986 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate |
| SMILES | CCCCCN1C(=O)C(CC(=O)OC)(c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C23H25NO5/c1-3-4-7-12-24-18-9-6-5-8-17(18)23(22(24)26,14-21(25)27-2)16-10-11-19-20(13-16)29-15-28-19/h5-6,8-11,13H,3-4,7,12,14-15H2,1-2H3 |
| InChIKey | BDOHZQWERPJXOY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate?
The IUPAC name of methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate (CID 12003986) is methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate.
What is the SMILES notation for methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate?
The canonical SMILES for methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate is CCCCCN1C(=O)C(CC(=O)OC)(c2ccc3c(c2)OCO3)c2ccccc21.
What is the InChIKey of methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate?
The InChIKey is BDOHZQWERPJXOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO5/c1-3-4-7-12-24-18-9-6-5-8-17(18)23(22(24)26,14-21(25)27-2)16-10-11-19-20(13-16)29-15-28-19/h5-6,8-11,13H,3-4,7,12,14-15H2,1-2H3.
What are the key properties of methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate?
methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate has a molecular weight of 395.46 g/mol, XLogP of 3.80, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]acetate is sourced from PubChem (CID 12003986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).