C17H19NO5 — CID 134956274
ethyl (2S)-2-[(2S)-but-3-en-2-yl]-7-nitro-1-oxo-3,4-dihydronaphthalene-2-carboxylate (PubChem CID 134956274) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is ethyl (2S)-2-[(2S)-but-3-en-2-yl]-7-nitro-1-oxo-3,4-dihydronaphthalene-2-carboxylate.
| Compound Name | ethyl (2S)-2-[(2S)-but-3-en-2-yl]-7-nitro-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 134956274 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | ethyl (2S)-2-[(2S)-but-3-en-2-yl]-7-nitro-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
| SMILES | C=C[C@H](C)[C@@]1(C(=O)OCC)CCc2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C17H19NO5/c1-4-11(3)17(16(20)23-5-2)9-8-12-6-7-13(18(21)22)10-14(12)15(17)19/h4,6-7,10-11H,1,5,8-9H2,2-3H3/t11-,17-/m0/s1 |
| InChIKey | WDBYJFRGIKQIDL-GTNSWQLSSA-N |
| XLogP | 3.10 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|