C15H19NO4S2 — CID 139350284
ethyl 2-[1-(3-nitrophenyl)ethyl]-1,3-dithiane-2-carboxylate (PubChem CID 139350284) has the molecular formula C15H19NO4S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is ethyl 2-[1-(3-nitrophenyl)ethyl]-1,3-dithiane-2-carboxylate.
| Compound Name | ethyl 2-[1-(3-nitrophenyl)ethyl]-1,3-dithiane-2-carboxylate |
|---|---|
| PubChem CID | 139350284 |
| Molecular Formula | C15H19NO4S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | ethyl 2-[1-(3-nitrophenyl)ethyl]-1,3-dithiane-2-carboxylate |
| SMILES | CCOC(=O)C1(C(C)c2cccc([N+](=O)[O-])c2)SCCCS1 |
| InChI | InChI=1S/C15H19NO4S2/c1-3-20-14(17)15(21-8-5-9-22-15)11(2)12-6-4-7-13(10-12)16(18)19/h4,6-7,10-11H,3,5,8-9H2,1-2H3 |
| InChIKey | XPDUYQXKSPHVIX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|