C13H15NO4S2 — CID 164869115
ethyl 2-[2-(3-nitrophenyl)-1,3-dithiolan-2-yl]acetate (PubChem CID 164869115) has the molecular formula C13H15NO4S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethyl 2-[2-(3-nitrophenyl)-1,3-dithiolan-2-yl]acetate.
| Compound Name | ethyl 2-[2-(3-nitrophenyl)-1,3-dithiolan-2-yl]acetate |
|---|---|
| PubChem CID | 164869115 |
| Molecular Formula | C13H15NO4S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | ethyl 2-[2-(3-nitrophenyl)-1,3-dithiolan-2-yl]acetate |
| SMILES | CCOC(=O)CC1(c2cccc([N+](=O)[O-])c2)SCCS1 |
| InChI | InChI=1S/C13H15NO4S2/c1-2-18-12(15)9-13(19-6-7-20-13)10-4-3-5-11(8-10)14(16)17/h3-5,8H,2,6-7,9H2,1H3 |
| InChIKey | ZRNAQKDNMJCNKK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|