C14H16ClNO4 — CID 22141336
ethyl 3-(chloromethyl)-2-methyl-2-(3-nitrophenyl)cyclopropane-1-carboxylate (PubChem CID 22141336) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is ethyl 3-(chloromethyl)-2-methyl-2-(3-nitrophenyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 3-(chloromethyl)-2-methyl-2-(3-nitrophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 22141336 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | ethyl 3-(chloromethyl)-2-methyl-2-(3-nitrophenyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(CCl)C1(C)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16ClNO4/c1-3-20-13(17)12-11(8-15)14(12,2)9-5-4-6-10(7-9)16(18)19/h4-7,11-12H,3,8H2,1-2H3 |
| InChIKey | OKKHRLSLAZHHLD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|