C17H22F2N2O5S — CID 71059332
ethyl 2-[(1R)-1-(tert-butylsulfinylamino)-6-nitro-2,3-dihydroinden-1-yl]-2,2-difluoroacetate (PubChem CID 71059332) has the molecular formula C17H22F2N2O5S and a molecular weight of 404.44 g/mol. Its IUPAC name is ethyl 2-[(1R)-1-(tert-butylsulfinylamino)-6-nitro-2,3-dihydroinden-1-yl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[(1R)-1-(tert-butylsulfinylamino)-6-nitro-2,3-dihydroinden-1-yl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 71059332 |
| Molecular Formula | C17H22F2N2O5S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | ethyl 2-[(1R)-1-(tert-butylsulfinylamino)-6-nitro-2,3-dihydroinden-1-yl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)[C@@]1(NS(=O)C(C)(C)C)CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H22F2N2O5S/c1-5-26-14(22)17(18,19)16(20-27(25)15(2,3)4)9-8-11-6-7-12(21(23)24)10-13(11)16/h6-7,10,20H,5,8-9H2,1-4H3/t16-,27?/m1/s1 |
| InChIKey | AAVKMMOZDOGMOP-DKEDTHNGSA-N |
| XLogP | 2.99 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|