C18H25F3N2O5S — CID 78111880
tert-butyl 3-(tert-butylsulfinylamino)-4,4,4-trifluoro-3-(4-nitrophenyl)butanoate (PubChem CID 78111880) has the molecular formula C18H25F3N2O5S and a molecular weight of 438.47 g/mol. Its IUPAC name is tert-butyl 3-(tert-butylsulfinylamino)-4,4,4-trifluoro-3-(4-nitrophenyl)butanoate.
| Compound Name | tert-butyl 3-(tert-butylsulfinylamino)-4,4,4-trifluoro-3-(4-nitrophenyl)butanoate |
|---|---|
| PubChem CID | 78111880 |
| Molecular Formula | C18H25F3N2O5S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | tert-butyl 3-(tert-butylsulfinylamino)-4,4,4-trifluoro-3-(4-nitrophenyl)butanoate |
| SMILES | CC(C)(C)OC(=O)CC(NS(=O)C(C)(C)C)(c1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C18H25F3N2O5S/c1-15(2,3)28-14(24)11-17(18(19,20)21,22-29(27)16(4,5)6)12-7-9-13(10-8-12)23(25)26/h7-10,22H,11H2,1-6H3 |
| InChIKey | JXHPHEDYPHQBRM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|