C11H11F2NO5 — CID 177164602
[1,1-difluoro-2-methyl-1-(4-nitrophenyl)propan-2-yl] hydrogen carbonate (PubChem CID 177164602) has the molecular formula C11H11F2NO5 and a molecular weight of 275.21 g/mol. Its IUPAC name is [1,1-difluoro-2-methyl-1-(4-nitrophenyl)propan-2-yl] hydrogen carbonate.
| Compound Name | [1,1-difluoro-2-methyl-1-(4-nitrophenyl)propan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 177164602 |
| Molecular Formula | C11H11F2NO5 |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | [1,1-difluoro-2-methyl-1-(4-nitrophenyl)propan-2-yl] hydrogen carbonate |
| SMILES | CC(C)(OC(=O)O)C(F)(F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H11F2NO5/c1-10(2,19-9(15)16)11(12,13)7-3-5-8(6-4-7)14(17)18/h3-6H,1-2H3,(H,15,16) |
| InChIKey | KKCPKQMLHANOIS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|