C11H13NO6 — CID 11118640
methyl 2,2-dimethoxy-2-(4-nitrophenyl)acetate (PubChem CID 11118640) has the molecular formula C11H13NO6 and a molecular weight of 255.23 g/mol. Its IUPAC name is methyl 2,2-dimethoxy-2-(4-nitrophenyl)acetate.
| Compound Name | methyl 2,2-dimethoxy-2-(4-nitrophenyl)acetate |
|---|---|
| PubChem CID | 11118640 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | methyl 2,2-dimethoxy-2-(4-nitrophenyl)acetate |
| SMILES | COC(=O)C(OC)(OC)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H13NO6/c1-16-10(13)11(17-2,18-3)8-4-6-9(7-5-8)12(14)15/h4-7H,1-3H3 |
| InChIKey | SEQZIOQVMJMUIQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|