C17H26O5 — CID 19797928
methyl 2-(4-hexoxyphenyl)-2,2-dimethoxyacetate (PubChem CID 19797928) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 2-(4-hexoxyphenyl)-2,2-dimethoxyacetate.
| Compound Name | methyl 2-(4-hexoxyphenyl)-2,2-dimethoxyacetate |
|---|---|
| PubChem CID | 19797928 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | methyl 2-(4-hexoxyphenyl)-2,2-dimethoxyacetate |
| SMILES | CCCCCCOc1ccc(C(OC)(OC)C(=O)OC)cc1 |
| InChI | InChI=1S/C17H26O5/c1-5-6-7-8-13-22-15-11-9-14(10-12-15)17(20-3,21-4)16(18)19-2/h9-12H,5-8,13H2,1-4H3 |
| InChIKey | PYYNHGUJTYHHGW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|