C17H14N2O7S2 — CID 132582293
methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate (PubChem CID 132582293) has the molecular formula C17H14N2O7S2 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate.
| Compound Name | methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 132582293 |
| Molecular Formula | C17H14N2O7S2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate |
| SMILES | COC(=O)C(Sc1ccc([N+](=O)[O-])cc1)(Sc1ccc([N+](=O)[O-])cc1)C(C)=O |
| InChI | InChI=1S/C17H14N2O7S2/c1-11(20)17(16(21)26-2,27-14-7-3-12(4-8-14)18(22)23)28-15-9-5-13(6-10-15)19(24)25/h3-10H,1-2H3 |
| InChIKey | ROUYIGMWNPJALM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|