methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate

C17H14N2O7S2 — CID 132582293

IUPACmethyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate
SMILESCOC(=O)C(Sc1ccc([N+](=O)[O-])cc1)(Sc1ccc([N+](=O)[O-])cc1)C(C)=O
InChIInChI=1S/C17H14N2O7S2/c1-11(20)17(16(21)26-2,27-14-7-3-12(4-8-14)18(22)23)28-15-9-5-13(6-10-15)19(24)25/h3-10H,1-2H3
InChIKeyROUYIGMWNPJALM-UHFFFAOYSA-N
MW422.44 g/mol
LogP3.85
Rot. Bonds8

About methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate

methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate (PubChem CID 132582293) has the molecular formula C17H14N2O7S2 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate.

Molecular Properties

Compound Namemethyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate
PubChem CID132582293
Molecular FormulaC17H14N2O7S2
Molecular Weight422.44 g/mol
Exact Mass422.02
IUPAC Namemethyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate
SMILESCOC(=O)C(Sc1ccc([N+](=O)[O-])cc1)(Sc1ccc([N+](=O)[O-])cc1)C(C)=O
InChIInChI=1S/C17H14N2O7S2/c1-11(20)17(16(21)26-2,27-14-7-3-12(4-8-14)18(22)23)28-15-9-5-13(6-10-15)19(24)25/h3-10H,1-2H3
InChIKeyROUYIGMWNPJALM-UHFFFAOYSA-N
XLogP3.85
TPSA129.65 Ų
H-Bond Donors
H-Bond Acceptors9
Rotatable Bonds8
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500422.44
LogP ≤ 53.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate?
The IUPAC name of methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate (CID 132582293) is methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate.
What is the SMILES notation for methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate?
The canonical SMILES for methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate is COC(=O)C(Sc1ccc([N+](=O)[O-])cc1)(Sc1ccc([N+](=O)[O-])cc1)C(C)=O.
What is the InChIKey of methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate?
The InChIKey is ROUYIGMWNPJALM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O7S2/c1-11(20)17(16(21)26-2,27-14-7-3-12(4-8-14)18(22)23)28-15-9-5-13(6-10-15)19(24)25/h3-10H,1-2H3.
What are the key properties of methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate?
methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate has a molecular weight of 422.44 g/mol, XLogP of 3.85, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-bis[(4-nitrophenyl)sulfanyl]-3-oxobutanoate is sourced from PubChem (CID 132582293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).