About methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene
methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene (PubChem CID 142273751) has the molecular formula C12H16N2O5
and a molecular weight of 268.27 g/mol. Its IUPAC name is methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene.
Molecular Properties
| Compound Name | methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene |
| PubChem CID | 142273751 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene |
| SMILES | COC(=O)CNC(C)=O.Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H7NO2.C5H9NO3/c1-6-2-4-7(5-3-6)8(9)10;1-4(7)6-3-5(8)9-2/h2-5H,1H3;3H2,1-2H3,(H,6,7) |
| InChIKey | YNHPSYHNFUBYTD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene?
The IUPAC name of methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene (CID 142273751) is methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene.
What is the SMILES notation for methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene?
The canonical SMILES for methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene is COC(=O)CNC(C)=O.Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene?
The InChIKey is YNHPSYHNFUBYTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C5H9NO3/c1-6-2-4-7(5-3-6)8(9)10;1-4(7)6-3-5(8)9-2/h2-5H,1H3;3H2,1-2H3,(H,6,7).
What are the key properties of methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene?
methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene has a molecular weight of 268.27 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamidoacetate;1-methyl-4-nitrobenzene is sourced from PubChem (CID 142273751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).