About [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate
[(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 11541047) has the molecular formula C17H17F3INO5S
and a molecular weight of 531.29 g/mol. Its IUPAC name is [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| PubChem CID | 11541047 |
| Molecular Formula | C17H17F3INO5S |
| Molecular Weight | 531.29 g/mol |
| Exact Mass | 530.98 |
| IUPAC Name | [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc(I(OS(=O)(=O)C(F)(F)F)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H17F3INO5S/c1-16(2,3)12-4-6-13(7-5-12)21(27-28(25,26)17(18,19)20)14-8-10-15(11-9-14)22(23)24/h4-11H,1-3H3 |
| InChIKey | BZPIRYOWRZVGJA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.29 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The IUPAC name of [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate (CID 11541047) is [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate.
What is the SMILES notation for [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The canonical SMILES for [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate is CC(C)(C)c1ccc(I(OS(=O)(=O)C(F)(F)F)c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The InChIKey is BZPIRYOWRZVGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3INO5S/c1-16(2,3)12-4-6-13(7-5-12)21(27-28(25,26)17(18,19)20)14-8-10-15(11-9-14)22(23)24/h4-11H,1-3H3.
What are the key properties of [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate?
[(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate has a molecular weight of 531.29 g/mol, XLogP of 5.22, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-tert-butylphenyl)-(4-nitrophenyl)-λ3-iodanyl] trifluoromethanesulfonate is sourced from PubChem (CID 11541047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).