C12H10F6INO9S2 — CID 134929536
[(E)-3-methoxy-1-[(4-nitrophenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]prop-1-en-2-yl] trifluoromethanesulfonate (PubChem CID 134929536) has the molecular formula C12H10F6INO9S2 and a molecular weight of 617.24 g/mol. Its IUPAC name is [(E)-3-methoxy-1-[(4-nitrophenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]prop-1-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [(E)-3-methoxy-1-[(4-nitrophenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]prop-1-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134929536 |
| Molecular Formula | C12H10F6INO9S2 |
| Molecular Weight | 617.24 g/mol |
| Exact Mass | 616.87 |
| IUPAC Name | [(E)-3-methoxy-1-[(4-nitrophenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]prop-1-en-2-yl] trifluoromethanesulfonate |
| SMILES | COC/C(=C\I(OS(=O)(=O)C(F)(F)F)c1ccc([N+](=O)[O-])cc1)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H10F6INO9S2/c1-27-7-10(28-30(23,24)11(13,14)15)6-19(29-31(25,26)12(16,17)18)8-2-4-9(5-3-8)20(21)22/h2-6H,7H2,1H3/b10-6+ |
| InChIKey | SMBFSOMWALLJTN-UXBLZVDNSA-N |
| XLogP | 3.41 |
| TPSA | 139.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|