About (4-nitrophenyl)azanium;trifluoromethanesulfonate
(4-nitrophenyl)azanium;trifluoromethanesulfonate (PubChem CID 15820537) has the molecular formula C7H7F3N2O5S
and a molecular weight of 288.20 g/mol. Its IUPAC name is (4-nitrophenyl)azanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (4-nitrophenyl)azanium;trifluoromethanesulfonate |
| PubChem CID | 15820537 |
| Molecular Formula | C7H7F3N2O5S |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | (4-nitrophenyl)azanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.[NH3+]c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C6H6N2O2.CHF3O3S/c7-5-1-3-6(4-2-5)8(9)10;2-1(3,4)8(5,6)7/h1-4H,7H2;(H,5,6,7) |
| InChIKey | JFETUWBJHWVBMV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)azanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)azanium;trifluoromethanesulfonate?
The IUPAC name of (4-nitrophenyl)azanium;trifluoromethanesulfonate (CID 15820537) is (4-nitrophenyl)azanium;trifluoromethanesulfonate.
What is the SMILES notation for (4-nitrophenyl)azanium;trifluoromethanesulfonate?
The canonical SMILES for (4-nitrophenyl)azanium;trifluoromethanesulfonate is O=S(=O)([O-])C(F)(F)F.[NH3+]c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)azanium;trifluoromethanesulfonate?
The InChIKey is JFETUWBJHWVBMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.CHF3O3S/c7-5-1-3-6(4-2-5)8(9)10;2-1(3,4)8(5,6)7/h1-4H,7H2;(H,5,6,7).
What are the key properties of (4-nitrophenyl)azanium;trifluoromethanesulfonate?
(4-nitrophenyl)azanium;trifluoromethanesulfonate has a molecular weight of 288.20 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)azanium;trifluoromethanesulfonate is sourced from PubChem (CID 15820537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).