C16H17N3O6S — CID 45146735
(4-nitrophenyl)azanium;4-(2-oxopyrrolidin-1-yl)benzenesulfonate (PubChem CID 45146735) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is (4-nitrophenyl)azanium;4-(2-oxopyrrolidin-1-yl)benzenesulfonate.
| Compound Name | (4-nitrophenyl)azanium;4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 45146735 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (4-nitrophenyl)azanium;4-(2-oxopyrrolidin-1-yl)benzenesulfonate |
| SMILES | O=C1CCCN1c1ccc(S(=O)(=O)[O-])cc1.[NH3+]c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H11NO4S.C6H6N2O2/c12-10-2-1-7-11(10)8-3-5-9(6-4-8)16(13,14)15;7-5-1-3-6(4-2-5)8(9)10/h3-6H,1-2,7H2,(H,13,14,15);1-4H,7H2 |
| InChIKey | ZDUJRNUHAFXMQW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|