C22H27F3INO5S — CID 24939027
(4-nitrophenyl)-[2,4,6-tri(propan-2-yl)phenyl]iodanium;trifluoromethanesulfonate (PubChem CID 24939027) has the molecular formula C22H27F3INO5S and a molecular weight of 601.43 g/mol. Its IUPAC name is (4-nitrophenyl)-[2,4,6-tri(propan-2-yl)phenyl]iodanium;trifluoromethanesulfonate.
| Compound Name | (4-nitrophenyl)-[2,4,6-tri(propan-2-yl)phenyl]iodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 24939027 |
| Molecular Formula | C22H27F3INO5S |
| Molecular Weight | 601.43 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | (4-nitrophenyl)-[2,4,6-tri(propan-2-yl)phenyl]iodanium;trifluoromethanesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c([I+]c2ccc([N+](=O)[O-])cc2)c(C(C)C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C21H27INO2.CHF3O3S/c1-13(2)16-11-19(14(3)4)21(20(12-16)15(5)6)22-17-7-9-18(10-8-17)23(24)25;2-1(3,4)8(5,6)7/h7-15H,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | LCMAIFBJHGHWAZ-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|