C22H30IO+ — CID 102410678
(4-methoxyphenyl)-[2,4,6-tri(propan-2-yl)phenyl]iodanium (PubChem CID 102410678) has the molecular formula C22H30IO+ and a molecular weight of 437.39 g/mol. Its IUPAC name is (4-methoxyphenyl)-[2,4,6-tri(propan-2-yl)phenyl]iodanium.
| Compound Name | (4-methoxyphenyl)-[2,4,6-tri(propan-2-yl)phenyl]iodanium |
|---|---|
| PubChem CID | 102410678 |
| Molecular Formula | C22H30IO+ |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (4-methoxyphenyl)-[2,4,6-tri(propan-2-yl)phenyl]iodanium |
| SMILES | COc1ccc([I+]c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc1 |
| InChI | InChI=1S/C22H30IO/c1-14(2)17-12-20(15(3)4)22(21(13-17)16(5)6)23-18-8-10-19(24-7)11-9-18/h8-16H,1-7H3/q+1 |
| InChIKey | QAXIAHAFZZIAJX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|