C16H18IO4+ — CID 122206249
(4-methoxyphenyl)-(2,4,6-trimethoxyphenyl)iodanium (PubChem CID 122206249) has the molecular formula C16H18IO4+ and a molecular weight of 401.22 g/mol. Its IUPAC name is (4-methoxyphenyl)-(2,4,6-trimethoxyphenyl)iodanium.
| Compound Name | (4-methoxyphenyl)-(2,4,6-trimethoxyphenyl)iodanium |
|---|---|
| PubChem CID | 122206249 |
| Molecular Formula | C16H18IO4+ |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | (4-methoxyphenyl)-(2,4,6-trimethoxyphenyl)iodanium |
| SMILES | COc1ccc([I+]c2c(OC)cc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C16H18IO4/c1-18-12-7-5-11(6-8-12)17-16-14(20-3)9-13(19-2)10-15(16)21-4/h5-10H,1-4H3/q+1 |
| InChIKey | XFXIBBOZXLGOOR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|