C13H14O3 — CID 102088907
1,3,7-trimethoxynaphthalene (PubChem CID 102088907) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 1,3,7-trimethoxynaphthalene.
| Compound Name | 1,3,7-trimethoxynaphthalene |
|---|---|
| PubChem CID | 102088907 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1,3,7-trimethoxynaphthalene |
| SMILES | COc1cc(OC)c2cc(OC)ccc2c1 |
| InChI | InChI=1S/C13H14O3/c1-14-10-5-4-9-6-11(15-2)8-13(16-3)12(9)7-10/h4-8H,1-3H3 |
| InChIKey | MEQGFDXLCWFGBH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |