C10H9F3N2O4S — CID 58533485
N-[ethyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide (PubChem CID 58533485) has the molecular formula C10H9F3N2O4S and a molecular weight of 310.25 g/mol. Its IUPAC name is N-[ethyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide.
| Compound Name | N-[ethyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58533485 |
| Molecular Formula | C10H9F3N2O4S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | N-[ethyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide |
| SMILES | CCS(=O)(=NC(=O)C(F)(F)F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H9F3N2O4S/c1-2-20(19,14-9(16)10(11,12)13)8-5-3-7(4-6-8)15(17)18/h3-6H,2H2,1H3 |
| InChIKey | HPTPQDNYPPOREW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|