About ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate
ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate (PubChem CID 59674069) has the molecular formula C10H12N2O5S
and a molecular weight of 272.28 g/mol. Its IUPAC name is ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate.
Molecular Properties
| Compound Name | ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate |
| PubChem CID | 59674069 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CCOC(=O)N=S(C)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H12N2O5S/c1-3-17-10(13)11-18(2,16)9-6-4-8(5-7-9)12(14)15/h4-7H,3H2,1-2H3 |
| InChIKey | FFAKHVHCJOGPAY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate?
The IUPAC name of ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate (CID 59674069) is ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate.
What is the SMILES notation for ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate?
The canonical SMILES for ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate is CCOC(=O)N=S(C)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate?
The InChIKey is FFAKHVHCJOGPAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O5S/c1-3-17-10(13)11-18(2,16)9-6-4-8(5-7-9)12(14)15/h4-7H,3H2,1-2H3.
What are the key properties of ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate?
ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate has a molecular weight of 272.28 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]carbamate is sourced from PubChem (CID 59674069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).