C14H15N3O5S — CID 138014469
3-ethyl-5-methyl-N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]-1,2-oxazole-4-carboxamide (PubChem CID 138014469) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is 3-ethyl-5-methyl-N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-ethyl-5-methyl-N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 138014469 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-ethyl-5-methyl-N-[methyl-(4-nitrophenyl)-oxo-λ6-sulfanylidene]-1,2-oxazole-4-carboxamide |
| SMILES | CCc1noc(C)c1C(=O)N=S(C)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H15N3O5S/c1-4-12-13(9(2)22-15-12)14(18)16-23(3,21)11-7-5-10(6-8-11)17(19)20/h5-8H,4H2,1-3H3 |
| InChIKey | SARRZYWXPBUTAS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 115.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|