C11H13F3N2O5S — CID 125136076
4-nitro-N-[(2R,3S)-1,1,1-trifluoro-2-hydroxypentan-3-yl]benzenesulfonamide (PubChem CID 125136076) has the molecular formula C11H13F3N2O5S and a molecular weight of 342.30 g/mol. Its IUPAC name is 4-nitro-N-[(2R,3S)-1,1,1-trifluoro-2-hydroxypentan-3-yl]benzenesulfonamide.
| Compound Name | 4-nitro-N-[(2R,3S)-1,1,1-trifluoro-2-hydroxypentan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 125136076 |
| Molecular Formula | C11H13F3N2O5S |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4-nitro-N-[(2R,3S)-1,1,1-trifluoro-2-hydroxypentan-3-yl]benzenesulfonamide |
| SMILES | CC[C@H](NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O5S/c1-2-9(10(17)11(12,13)14)15-22(20,21)8-5-3-7(4-6-8)16(18)19/h3-6,9-10,15,17H,2H2,1H3/t9-,10+/m0/s1 |
| InChIKey | JVOLXBHYOGKGHI-VHSXEESVSA-N |
| XLogP | 1.57 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|