C13H18F3N3O4S — CID 162538188
N-[(2S)-3-methyl-1-(2,2,2-trifluoroethylamino)butan-2-yl]-4-nitrobenzenesulfonamide (PubChem CID 162538188) has the molecular formula C13H18F3N3O4S and a molecular weight of 369.37 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-(2,2,2-trifluoroethylamino)butan-2-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(2S)-3-methyl-1-(2,2,2-trifluoroethylamino)butan-2-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 162538188 |
| Molecular Formula | C13H18F3N3O4S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-[(2S)-3-methyl-1-(2,2,2-trifluoroethylamino)butan-2-yl]-4-nitrobenzenesulfonamide |
| SMILES | CC(C)[C@@H](CNCC(F)(F)F)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18F3N3O4S/c1-9(2)12(7-17-8-13(14,15)16)18-24(22,23)11-5-3-10(4-6-11)19(20)21/h3-6,9,12,17-18H,7-8H2,1-2H3/t12-/m1/s1 |
| InChIKey | FUHBBEZRZSEJFG-GFCCVEGCSA-N |
| XLogP | 2.05 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|